COMPOUND GROUP NAME | POPULATION STATUS | DATE POPULATED | DESCRIPTION | PROFILE TYPE | # MEMBERS | # HAZARDS |
---|---|---|---|---|---|---|
Tail gas (petroleum), processed, distillates and fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 31 | 0 | |
Tar acids, distillate phenols, crude phenols and other related fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 14 | 0 | |
Tar bases, coal and other Distillate Bases | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 0 | |
Tar oils, coal and oil fractions | incomplete | This compound group has not yet been assigned a structural definition. | other | 3 | 0 | |
Tar, brown-coal | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 0 | |
Tars, coal | incomplete | This compound group has not yet been assigned a structural definition. | other | 11 | 0 | |
Tetraalkyl lead compounds | in progress | This compound group has not yet been assigned a structural definition. One approach would be to use the SMILES string 'C[Pb](*C)(C)C' and remove substances containing 'c[Pb]' (lowercase specifies aromatic). There are technical challenges since PubChem doesn't seem to provide an option to distinguish between aromatic and aliphatic carbons. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 22 | 73 | |
Tetrachlorobenzenes | complete | This compound group has not yet been assigned a structural definition. | other | 5 | 7 | |
TETRACYCLINES | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 2 | |
THALLIUM (I), SOLUBLE SALTS | incomplete | This compound group has not yet been assigned a structural definition. | other | 7 | 4 | |
Thiazoles | incomplete | This compound group is defined by the SMILES string 'C1=CSC=N1'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
other | 0 | 1 | |
Thioglycolates | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 2 | |
Thiurams | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 1 | |
TIN COMPOUNDS, INORGANIC | in progress | This compound group is defined by the SMILES string '[Sn]' and subsequently filtered to remove substances containing '[C]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 2 | 7 | |
Titanium dioxide compounds | incomplete | This compound group has not yet been assigned a structural definition. |
other | 10 | 7 | |
Toluenediisocyanates (MAK list) | incomplete | This groups is populated from three chemicals in the MAK list. |
other | 0 | 3 | |
Toxic Heavy Metals | incomplete | Compounds containing
|
other | 5548 | 2 | |
Trialkyl tin hydroxide | incomplete | This compound group has not yet been assigned a structural definition. Distinguishing between alkyl and aryl side chains is not straightforward in PubChem's substructure searches. The SMILES string "[CH2][Sn]([CH2])([CH2])[OH]" captures the relevant groups but is not specific enough. |
other | 0 | 6 | |
Trialkyltinhydroxide, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 6 | |
Trialkyltinoxide | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 6 | |
Triaryl tin hydroxide | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 6 | |
Tributyltin compounds, with the exception of those specified elsewhere in Annex XVII of Regulation (EC) No 1907/2006 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 118 | 41 | |
tributyltin compounds, with the exception of those specified elsewhere in this annex | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 119 | 51 | |
Trichlorobenzenes | complete | This compound group has not yet been assigned a structural definition. | other | 4 | 6 | |
Trichlorophenol and its salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 9 | 0 | |
Trihalomethanes | incomplete | This compound group is defined by the SMILES string '[CH]([F,Cl,Br,I])([F,Cl,Br,I])[F,Cl,Br,I]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | other | 4 | 0 | |
Trimethylbenzene isomers | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 1 | |
Trimethylhexamethylene-1,6-di-isocyanates | incomplete | This compound group has not yet been assigned a structural definition. | other | 2 | 0 | |
Trimethylpentane isomers | incomplete | This compound group has not yet been assigned a structural definition. | other | 10 | 2 | |
Trimethyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 2 | 26 | |
Trinickel, other salts | incomplete | This compound group has not yet been assigned a structural definition. | other | 6 | 0 | |
Triphenyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 3 | 37 | |
Triphenyltin fatty acid ester (alkyl C=9-11) | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 34 | |
Tripropyltin compounds, with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 0 | 23 | |
Uranium compounds with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 3 | 7 | |
Uranium compounds, insoluble | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 2 | |
Uranium compounds, soluble inorganic | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 5 | |
Vanadium compounds, inorganic | in progress | other | 250 | 4 | ||
Vinyl halides | complete | This compound group is composed of four chemicals so no substructure search is needed to populate it |
other | 4 | 2 | |
Volatile esters of bromoacetic acids | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 2 | |
Volatile Methylated Siloxanes (VMS) | incomplete | This compound group has not yet been assigned a structural definition. |
other | 9 | 3 | |
VOLATILE ORGANIC COMPOUNDS | incomplete | This compound group has not yet been assigned a structural definition. | other | 1 | 1 | |
Warfarin, salts | incomplete | This compound group has not yet been assigned a structural definition. |
other | 1 | 6 | |
XYLENE COMPOUNDS | incomplete | This compound group has not yet been assigned a structural definition. | other | 16 | 2 | |
Xylidine isomers | incomplete | This compound group has not yet been assigned a structural definition. |
other | 9 | 1 | |
Xylidines with the exception of those specified elsewhere in Annex VI of Regulation (EC) No 1272/2008 | incomplete | This compound group is populated by taking the more general compound group and subtracting the chemicals found in the relevent Annex. |
other | 6 | 7 | |
Zinc Alloys | incomplete | This compound group has not yet been assigned a structural definition. |
other | 0 | 0 | |
Zirconium, insoluble compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 5 | |
Zirconium, soluble compounds | incomplete | This compound group has not yet been assigned a structural definition. | other | 0 | 4 |