COMPOUND GROUP NAME | POPULATION STATUS | DATE POPULATED | DESCRIPTION | PROFILE TYPE | # MEMBERS | # HAZARDS |
---|---|---|---|---|---|---|
Butanilicaine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Butopiprine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Butyltin compounds | in progress | This compound group is populated by its subgroups. |
structure | 212 | 15 | |
Caramiphen and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Cephaeline and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Chloramine T and related compounds, Tosylchloramide sodium (INN) | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Chlorinated Organic Compounds | incomplete | This compound group is defined by the SMILES string 'C[Cl]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | structure | 3970 | 6 | |
Chlormethine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
chloronitroanilines | incomplete | This compound group has not yet been assigned a structural definition. |
structure | 1 | 0 | |
Chloroplatinates | incomplete | This compound group has not yet been assigned a structural definition. |
structure | 5 | 1 | |
Chlorprothixene and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Choline salts and their esters | incomplete | This compound group has not yet been assigned a structural definition. | structure | 2 | 1 | |
Cinchocaine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Cinchophen, its salts, derivatives and salts of these derivatives | incomplete | This compound group has not yet been assigned a structural definition. | structure | 2 | 1 | |
Cobalt nickel compounds | incomplete | This compound group has not yet been assigned a structural definition. | structure | 4 | 0 | |
Colchicine, its salts and derivatives | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Colchicoside and its derivatives | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Colouring agent CI 12075 | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
CYANIDE COMPOUNDS | complete | This compound group includes both commercially relevant compounds such as Hydrogen Cyanide, Sodium Cyanide, Potassium Cyanide, and Calcium Cyanide, as well as cyanide salts that are less common. |
structure | 39 | 8 | |
Cyclizine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Cyclomenol and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Cyclophosphamide and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Decamethonium bromide | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Dextromethorphan and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Dibutyltin compounds | in progress | This compound group is defined by the SMILES string 'CCCC[Sn]CCCC.CCCC[Sn]CCCC'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 83 | 21 | |
Dimethylarsenic acids | complete | This compound group is defined by the SMILES string '[CH3][As](=O)([CH3])O'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 18 | 39 | |
Dimethyltin derivatives | complete | 07/26/18 | This compound group is defined by the SMILES string '[CH3][Sn]([CH3])', then subtracting compounds with 3+ methyl ligands. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 276 | 17 |
Dimevamide and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Dinoseb salts and esters | incomplete | This compound group is defined by the SMILES string 'CCC(C)C1=CC(=CC(=C1O)[N+](=O)[O-])[N+](=O)[O-]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 10 | 1 | |
Dinoterb salts and esters | complete | This compound group is defined by a substructure search of PubChem the SMILES/SMARTS string "[CH3]C([CH3])([CH3])C1=[CH1]C(=[CH1]C(=C1[OD1])[N+](=O)[O-])[N+](=O)[O-] plus [CH3]C([CH3])([CH3])C1=[CH1]C(=[CH1]C(=C1OC(=O)C)[N+](=O)[O-])[N+](=O)[O-]". The setting "Remove any explicit hydrogens before searching" was deselected from each substructure search. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 7 | 9 | |
Dioctyltin compounds | in progress | This compound group is defined by the SMILES string 'CCCCCCCC[Sn]CCCCCCCC'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 12 | 21 | |
Dioxethedrin and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Diphenhydramine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Diphenylpyraline and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Diphenyltin derivatives | complete | 07/26/18 | This compound group is defined by the SMILES string '[CH]1=[CH][CH]=C([CH]=[CH]1)[Sn](C2=[CH][CH]=[CH][CH]=[CH]2)'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 153 | 19 |
Doxylamine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Emetine, its salts and derivatives | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Eserine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Ethanol, 2,2'-iminobis-, reaction products with epichlorohydrin and 2-nitro-1,4-benzenediamine (HC Blue No. 5) and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 2 | 1 | |
Ethoheptazine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Fluorinated Organic Compounds | incomplete | This compound group is defined by the SMILES string 'C[F]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | structure | 11690 | 3 | |
Glutethimide and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Guanethidine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
HALOGENATED ORGANIC COMPOUNDS | incomplete | This compound group is defined by the SMILES string 'C[F,Cl,Br,I]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 16965 | 3 | |
HBCDD / HBCD isomers | complete | This compound group is defined by the SMILES/SMARTS string "C1CC(C(CCC(C(CCC(C1Br)Br)Br)Br)Br)Br" and populated from a substructure search of PubChem. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system.
|
structure | 32 | 11 | |
HEXACHLOROCYCLOHEXANE ISOMERS | in progress | This compound group should include additional isomers. We're starting with 1,2,3,4,5,6 hexaclorocyclohexane isomers, which can be represented by the SMILES string C1(C(C(C(C(C1(Cl)[H])(Cl)[H])(Cl)[H])(Cl)[H])(Cl)[H])(Cl)[H]. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 6 | 7 | |
hexachloroplatinates | incomplete | This compound group has not yet been assigned a structural definition. |
structure | 1 | 1 | |
Hydrastinine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Hydrazides and their salts, Isoniazid | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Hydrazine salts | incomplete | This compound group is defined by the SMILES string '[NH2D3][NH2D3]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 86 | 18 | |
Hydrofluoric acid, its normal salts, its complexes and hydrofluorides | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Hydrofluoroolefins (HFOs) | incomplete | This compound group does not have a definition yet. |
structure | 3 | 0 | |
inorganic sulfites and bisulfites | incomplete | 09/01/20 | structure | 7 | 0 | |
Iodinated Organic Compounds | incomplete | This compound group is defined by the SMILES string 'C[I]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | structure | 298 | 3 | |
Iron-Zinc compounds | incomplete | This compound group has not yet been assigned a structural definition. |
structure | 3 | 9 | |
ISOCYANATES | complete | 07/19/17 | This compound group is defined by the SMARTS string "[NX2:2]=[C:1]=[OX1:3]". For more information on SMARTS, see https://en.wikipedia.org/wiki/Smiles_arbitrary_target_specification. |
structure | 2936 | 2 |
Lead carbonates | incomplete | This compound group has not yet been assigned a structural definition. | structure | 0 | 56 | |
LEAD COMPOUNDS, ORGANIC | in progress | This compound group is defined by the SMILES string 'C[Pb]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | structure | 235 | 52 | |
Lead sulphates | incomplete | This compound group has not yet been assigned a structural definition. | structure | 0 | 56 | |
Lobeline and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
long-chain perfluoroalkyl sulfonate (C6 and higher) | incomplete | This compound group was populated by a substructure search in PubChem using the SMILES string for PFHS (perfluorohexanesulfonate), replacing terminal CF3 with CF2 to allow for longer chain lengths: C(C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(F)F)(C(C(F)F)(F)F)(F)F |
structure | 96 | 17 | |
long-chain perfluorocarboxylic acids (C8 and higher) | incomplete | This compound group was populated by a substructure search in PubChem using the SMILES string for PFOA, but replacing the terminal CF3 with CF2 to allow for longer chains: C(=O)(C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O Esters and ethers were manually removed. |
structure | 77 | 23 | |
Lysergide and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Mannomustine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Mefeclorazine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Mephenesin and its esters | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Mercury Compounds, Alkyloxyalkyl and aryl mercury compounds | incomplete | The list can be derived from the PIC Rotterdam Convention Annex III tables http://www.pic.int/Default.aspx?tabid=1132. |
structure | 30 | 45 | |
Mercury Compounds, Methylmercury | incomplete | This compound group is defined by the SMILES string '[CH3][Hg]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | structure | 7 | 47 | |
MERCURY COMPOUNDS, ORGANIC | in progress | This compound group is defined by the SMILES string 'C[Hg]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | structure | 997 | 44 | |
Mercury, organic compounds (MAK) | complete | MAK provides the following criteria for the organic mercury compounds it flags as hazardous. This compound group is defined by the SMILES/SMARTS string "C[Hg]" and populated from a substructure search of PubChem. "Organomercury compounds are characterized chemically by the covalent binding of one or two alkyl or aryl groups and covalent or ionic binding of a group such as halide,hydroxide, acetate, nitrate or phosphate to the mercury atom." https://onlinelibrary.wiley.com/doi/10.1002/3527600418.mb743997orge0015 |
structure | 965 | 46 | |
Mescaline and its salts, 3,4,5-Trimethoxyphenethylamine | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
metal salts of thiocyanic acid | incomplete | This compound group has not yet been assigned a structural definition. |
structure | 1 | 0 | |
Metethoheptazine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Metformin and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Methapyrilene and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Metheptazine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Methylarsenic compounds | complete | This compound group is defined by a substructure search of PubChem the SMILES/SMARTS string "[As][CH3]". The setting "Remove any explicit hydrogens before searching" was deselected from the substructure search. |
structure | 398 | 39 | |
METHYLHYDRAZINE SALTS | in progress | This compound group is defined by the SMILES string '[CH3][NH][NH2]' or the SMARTS string '[CD1][ND2][ND1]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 1 | 7 | |
Methylphenidate and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Methyprylon and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Mono- and di-phthalate esters with linear and/or branched alkyl moieties with at least one longest continuous carbon chain counted from the ester function corresponding to C4-C6 and/or with C6 cyclic saturated carbon chains and/or with unsaturated hydrocarbyl moieties | incomplete | structure | 0 | 1 | ||
Monobutyltin compounds | in progress | This compound group is defined by the SMILES string '[Sn][CH2][CH2][CH2][CH3]' subtracting compounds with 2+ butyl ligands. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 0 | 21 | |
Monometharsonic acids | complete | This compound group is defined by A PubChem Substructure search of the SMILES/SMARTS string "[CH3][As](=O)(O)O". The setting "Remove any explicit hydrogens before searching" was deselected from the substructure search. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system.
|
structure | 34 | 39 | |
Monomethyltin derivatives | complete | 07/26/18 | This compound group is defined by the SMILES string '[Sn][CH3]' subtracting compounds with 2+ methyl ligands. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 95 | 17 |
Monooctyltin compounds | in progress | This compound group is defined by the SMILES string '[Sn][CH2][CH2][CH2][CH2][CH2][CH2][CH2][CH3]', then subtracting compounds with 2+ octyl ligands. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 0 | 19 | |
Monophenyltin derivatives | complete | 07/26/18 | This compound group is defined by the SMILES string '[CH]1=[CH][CH]=C([CH]=[CH]1)[Sn]', then subtracting compounds matching diphenyltin. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 70 | 19 |
Morpholine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
N-5-Chlorobenzoxazol-2-ylacetamide and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
N,N-bis(2-Chloroethyl)methylamine N-oxide and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
N,N''-bis(4-Chlorophenyl)-3,12-diimino-2,4,11,13-tetraazatetradecanediamidine digluconate, Chlorhexidine and its salts, Chlorhexidine gluconate | incomplete | This compound group has not yet been assigned a structural definition. | structure | 3 | 1 | |
Nalorphine, its salts and ethers | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Naphazoline and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Neodymium and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Neostigmine and its salts | incomplete | This compound group has not yet been assigned a structural definition. | structure | 2 | 1 | |
Nerium oleander its extracts and its glycosides, Oleandrin | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 | |
Nickel compounds, inorganic | complete | This compound group is defined by the SMILES/SMARTS string "[Ni] subtract [Ni].C" and populated from a substructure search of PubChem. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. |
structure | 507 | 1 | |
Nickel compounds, oxidic | complete | This compound group is defined by the SMILES/SMARTS string "O=[Ni]" and populated from a substructure search of PubChem. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. "including nickel oxide, nickel-copper oxide, nickel silicate oxides, and complex oxides" |
structure | 29 | 28 | |
Nickel compounds, sulfidic | incomplete | This compound group has not yet been assigned a structural definition. | structure | 6 | 28 | |
Nickel, other organic compounds | incomplete | This compound group is defined by the SMILES string 'C[Ni]'. For more information on SMILES, see https://en.wikipedia.org/wiki/Simplified_molecular-input_line-entry_system. | structure | 31 | 0 | |
Nitrites, inorganic, except sodium nitrite | incomplete | This compound group has not yet been assigned a structural definition. | structure | 1 | 1 |